C31H32O15 — CID 162892858
[6-[3-(3,4-dimethoxybenzoyl)-2,4,6-trihydroxyphenyl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 162892858) has the molecular formula C31H32O15 and a molecular weight of 644.58 g/mol. Its IUPAC name is [6-[3-(3,4-dimethoxybenzoyl)-2,4,6-trihydroxyphenyl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [6-[3-(3,4-dimethoxybenzoyl)-2,4,6-trihydroxyphenyl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162892858 |
| Molecular Formula | C31H32O15 |
| Molecular Weight | 644.58 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | [6-[3-(3,4-dimethoxybenzoyl)-2,4,6-trihydroxyphenyl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C(=O)c2c(O)cc(O)c(C3OC(CO)C(OC(=O)C=Cc4cc(O)c(O)c(OC)c4)C(O)C3O)c2O)cc1OC |
| InChI | InChI=1S/C31H32O15/c1-42-18-6-5-14(10-19(18)43-2)25(37)23-15(33)11-16(34)24(27(23)39)31-29(41)28(40)30(21(12-32)45-31)46-22(36)7-4-13-8-17(35)26(38)20(9-13)44-3/h4-11,21,28-35,38-41H,12H2,1-3H3 |
| InChIKey | BGJBKQGLLFXZSS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 242.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.58 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|