C13H16O9 — CID 74323795
(3,4,5,6-tetrahydroxyoxan-2-yl)methyl 3,4-dihydroxybenzoate (PubChem CID 74323795) has the molecular formula C13H16O9 and a molecular weight of 316.26 g/mol. Its IUPAC name is (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 3,4-dihydroxybenzoate.
| Compound Name | (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 3,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 74323795 |
| Molecular Formula | C13H16O9 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 3,4-dihydroxybenzoate |
| SMILES | O=C(OCC1OC(O)C(O)C(O)C1O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H16O9/c14-6-2-1-5(3-7(6)15)12(19)21-4-8-9(16)10(17)11(18)13(20)22-8/h1-3,8-11,13-18,20H,4H2 |
| InChIKey | JBLVGFKMCLXCOP-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|