C19H20O9 — CID 73104452
[6-(3,4-dihydroxyphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl benzoate (PubChem CID 73104452) has the molecular formula C19H20O9 and a molecular weight of 392.36 g/mol. Its IUPAC name is [6-(3,4-dihydroxyphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl benzoate.
| Compound Name | [6-(3,4-dihydroxyphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 73104452 |
| Molecular Formula | C19H20O9 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [6-(3,4-dihydroxyphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1OC(Oc2ccc(O)c(O)c2)C(O)C(O)C1O)c1ccccc1 |
| InChI | InChI=1S/C19H20O9/c20-12-7-6-11(8-13(12)21)27-19-17(24)16(23)15(22)14(28-19)9-26-18(25)10-4-2-1-3-5-10/h1-8,14-17,19-24H,9H2 |
| InChIKey | NAXRNCZKQQXVIW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|