C28H24O12 — CID 74977677
[6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl benzoate (PubChem CID 74977677) has the molecular formula C28H24O12 and a molecular weight of 552.49 g/mol. Its IUPAC name is [6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl benzoate.
| Compound Name | [6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 74977677 |
| Molecular Formula | C28H24O12 |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | [6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1OC(Oc2cc(O)c3c(=O)cc(-c4ccc(O)c(O)c4)oc3c2)C(O)C(O)C1O)c1ccccc1 |
| InChI | InChI=1S/C28H24O12/c29-16-7-6-14(8-17(16)30)20-11-19(32)23-18(31)9-15(10-21(23)39-20)38-28-26(35)25(34)24(33)22(40-28)12-37-27(36)13-4-2-1-3-5-13/h1-11,22,24-26,28-31,33-35H,12H2 |
| InChIKey | WQJPXRDOEHYGGB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 196.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|