C28H24O13 — CID 163184122
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl 3,4-dihydroxybenzoate (PubChem CID 163184122) has the molecular formula C28H24O13 and a molecular weight of 568.49 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl 3,4-dihydroxybenzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl 3,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 163184122 |
| Molecular Formula | C28H24O13 |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl 3,4-dihydroxybenzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)[C@H](O)[C@@H](O)[C@@H]1O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C28H24O13/c29-14-4-1-12(2-5-14)20-10-19(33)23-18(32)8-15(9-21(23)40-20)39-28-26(36)25(35)24(34)22(41-28)11-38-27(37)13-3-6-16(30)17(31)7-13/h1-10,22,24-26,28-32,34-36H,11H2/t22-,24-,25+,26-,28-/m1/s1 |
| InChIKey | VXJALOUMGIURLW-HOZVGSINSA-N |
| XLogP | 1.33 |
| TPSA | 216.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|