C38H48NO7PS — CID 155520392
methanesulfonate;triphenyl-[10-[3-(3,4,5-trihydroxyphenyl)propanoylamino]decyl]phosphanium (PubChem CID 155520392) has the molecular formula C38H48NO7PS and a molecular weight of 693.84 g/mol. Its IUPAC name is methanesulfonate;triphenyl-[10-[3-(3,4,5-trihydroxyphenyl)propanoylamino]decyl]phosphanium.
| Compound Name | methanesulfonate;triphenyl-[10-[3-(3,4,5-trihydroxyphenyl)propanoylamino]decyl]phosphanium |
|---|---|
| PubChem CID | 155520392 |
| Molecular Formula | C38H48NO7PS |
| Molecular Weight | 693.84 g/mol |
| Exact Mass | 693.29 |
| IUPAC Name | methanesulfonate;triphenyl-[10-[3-(3,4,5-trihydroxyphenyl)propanoylamino]decyl]phosphanium |
| SMILES | CS(=O)(=O)[O-].O=C(CCc1cc(O)c(O)c(O)c1)NCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H44NO4P.CH4O3S/c39-34-28-30(29-35(40)37(34)42)24-25-36(41)38-26-16-5-3-1-2-4-6-17-27-43(31-18-10-7-11-19-31,32-20-12-8-13-21-32)33-22-14-9-15-23-33;1-5(2,3)4/h7-15,18-23,28-29H,1-6,16-17,24-27H2,(H3-,38,39,40,41,42);1H3,(H,2,3,4) |
| InChIKey | ASLSXCZSFITFLV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 146.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.84 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|