C23H27O6PS2 — CID 87060000
methanesulfonate;triphenyl(4-sulfobutyl)phosphanium (PubChem CID 87060000) has the molecular formula C23H27O6PS2 and a molecular weight of 494.57 g/mol. Its IUPAC name is methanesulfonate;triphenyl(4-sulfobutyl)phosphanium.
| Compound Name | methanesulfonate;triphenyl(4-sulfobutyl)phosphanium |
|---|---|
| PubChem CID | 87060000 |
| Molecular Formula | C23H27O6PS2 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | methanesulfonate;triphenyl(4-sulfobutyl)phosphanium |
| SMILES | CS(=O)(=O)[O-].O=S(=O)(O)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23O3PS.CH4O3S/c23-27(24,25)19-11-10-18-26(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22;1-5(2,3)4/h1-9,12-17H,10-11,18-19H2;1H3,(H,2,3,4) |
| InChIKey | XBAYUXBVXRGOLM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|