C28H29O6PS2 — CID 171374676
4-methylbenzenesulfonic acid;3-triphenylphosphaniumylpropane-1-sulfonate (PubChem CID 171374676) has the molecular formula C28H29O6PS2 and a molecular weight of 556.64 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;3-triphenylphosphaniumylpropane-1-sulfonate.
| Compound Name | 4-methylbenzenesulfonic acid;3-triphenylphosphaniumylpropane-1-sulfonate |
|---|---|
| PubChem CID | 171374676 |
| Molecular Formula | C28H29O6PS2 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | 4-methylbenzenesulfonic acid;3-triphenylphosphaniumylpropane-1-sulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=S(=O)([O-])CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21O3PS.C7H8O3S/c22-26(23,24)18-10-17-25(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;1-6-2-4-7(5-3-6)11(8,9)10/h1-9,11-16H,10,17-18H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | AOKLGVCURZKCAC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|