C21H25FN2O — CID 110440843
(E)-3-[4-(dimethylamino)phenyl]-N-[2-(2-fluorophenyl)-2-methylpropyl]prop-2-enamide (PubChem CID 110440843) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is (E)-3-[4-(dimethylamino)phenyl]-N-[2-(2-fluorophenyl)-2-methylpropyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(dimethylamino)phenyl]-N-[2-(2-fluorophenyl)-2-methylpropyl]prop-2-enamide |
|---|---|
| PubChem CID | 110440843 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (E)-3-[4-(dimethylamino)phenyl]-N-[2-(2-fluorophenyl)-2-methylpropyl]prop-2-enamide |
| SMILES | CN(C)c1ccc(/C=C/C(=O)NCC(C)(C)c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H25FN2O/c1-21(2,18-7-5-6-8-19(18)22)15-23-20(25)14-11-16-9-12-17(13-10-16)24(3)4/h5-14H,15H2,1-4H3,(H,23,25)/b14-11+ |
| InChIKey | ICEOKGOTXUITMH-SDNWHVSQSA-N |
| XLogP | 4.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|