C19H22F2N2O — CID 60614116
1-[(4-fluorophenyl)methyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]-1-methylurea (PubChem CID 60614116) has the molecular formula C19H22F2N2O and a molecular weight of 332.39 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]-1-methylurea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]-1-methylurea |
|---|---|
| PubChem CID | 60614116 |
| Molecular Formula | C19H22F2N2O |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]-1-methylurea |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)NCC(C)(C)c1ccccc1F |
| InChI | InChI=1S/C19H22F2N2O/c1-19(2,16-6-4-5-7-17(16)21)13-22-18(24)23(3)12-14-8-10-15(20)11-9-14/h4-11H,12-13H2,1-3H3,(H,22,24) |
| InChIKey | AFLRVKKXYPQUAM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |