C16H23FN2O2 — CID 110913086
1-cyclopropyl-3-[2-(2-fluorophenyl)-2-methylpropyl]-1-(2-hydroxyethyl)urea (PubChem CID 110913086) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(2-fluorophenyl)-2-methylpropyl]-1-(2-hydroxyethyl)urea.
| Compound Name | 1-cyclopropyl-3-[2-(2-fluorophenyl)-2-methylpropyl]-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110913086 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-cyclopropyl-3-[2-(2-fluorophenyl)-2-methylpropyl]-1-(2-hydroxyethyl)urea |
| SMILES | CC(C)(CNC(=O)N(CCO)C1CC1)c1ccccc1F |
| InChI | InChI=1S/C16H23FN2O2/c1-16(2,13-5-3-4-6-14(13)17)11-18-15(21)19(9-10-20)12-7-8-12/h3-6,12,20H,7-11H2,1-2H3,(H,18,21) |
| InChIKey | KIUDQILCICDVPY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |