C16H22N2 — CID 84630578
2,4,7-trimethyl-3-(pyrrolidin-2-ylmethyl)-1H-indole (PubChem CID 84630578) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2,4,7-trimethyl-3-(pyrrolidin-2-ylmethyl)-1H-indole.
| Compound Name | 2,4,7-trimethyl-3-(pyrrolidin-2-ylmethyl)-1H-indole |
|---|---|
| PubChem CID | 84630578 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2,4,7-trimethyl-3-(pyrrolidin-2-ylmethyl)-1H-indole |
| SMILES | Cc1[nH]c2c(C)ccc(C)c2c1CC1CCCN1 |
| InChI | InChI=1S/C16H22N2/c1-10-6-7-11(2)16-15(10)14(12(3)18-16)9-13-5-4-8-17-13/h6-7,13,17-18H,4-5,8-9H2,1-3H3 |
| InChIKey | XTZYKCOQRJJWMQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |