C17H24N2 — CID 84636243
2,6,7-trimethyl-3-(piperidin-3-ylmethyl)-1H-indole (PubChem CID 84636243) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2,6,7-trimethyl-3-(piperidin-3-ylmethyl)-1H-indole.
| Compound Name | 2,6,7-trimethyl-3-(piperidin-3-ylmethyl)-1H-indole |
|---|---|
| PubChem CID | 84636243 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2,6,7-trimethyl-3-(piperidin-3-ylmethyl)-1H-indole |
| SMILES | Cc1ccc2c(CC3CCCNC3)c(C)[nH]c2c1C |
| InChI | InChI=1S/C17H24N2/c1-11-6-7-15-16(9-14-5-4-8-18-10-14)13(3)19-17(15)12(11)2/h6-7,14,18-19H,4-5,8-10H2,1-3H3 |
| InChIKey | GCOQXEGSKRWELL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|