C18H26N2 — CID 96679083
N-[2-(2,6,7-trimethyl-1H-indol-3-yl)ethyl]cyclopentanamine (PubChem CID 96679083) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[2-(2,6,7-trimethyl-1H-indol-3-yl)ethyl]cyclopentanamine.
| Compound Name | N-[2-(2,6,7-trimethyl-1H-indol-3-yl)ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 96679083 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-[2-(2,6,7-trimethyl-1H-indol-3-yl)ethyl]cyclopentanamine |
| SMILES | Cc1ccc2c(CCNC3CCCC3)c(C)[nH]c2c1C |
| InChI | InChI=1S/C18H26N2/c1-12-8-9-17-16(14(3)20-18(17)13(12)2)10-11-19-15-6-4-5-7-15/h8-9,15,19-20H,4-7,10-11H2,1-3H3 |
| InChIKey | MXABDJOUOYILOE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|