C18H26N2 — CID 96679064
N-[2-(5-tert-butyl-2-methyl-1H-indol-3-yl)ethyl]cyclopropanamine (PubChem CID 96679064) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[2-(5-tert-butyl-2-methyl-1H-indol-3-yl)ethyl]cyclopropanamine.
| Compound Name | N-[2-(5-tert-butyl-2-methyl-1H-indol-3-yl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 96679064 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-[2-(5-tert-butyl-2-methyl-1H-indol-3-yl)ethyl]cyclopropanamine |
| SMILES | Cc1[nH]c2ccc(C(C)(C)C)cc2c1CCNC1CC1 |
| InChI | InChI=1S/C18H26N2/c1-12-15(9-10-19-14-6-7-14)16-11-13(18(2,3)4)5-8-17(16)20-12/h5,8,11,14,19-20H,6-7,9-10H2,1-4H3 |
| InChIKey | UWVBBQDYDRBWCV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|