C18H24ClN3S — CID 43952994
1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-cyclohexylthiourea (PubChem CID 43952994) has the molecular formula C18H24ClN3S and a molecular weight of 349.93 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-cyclohexylthiourea.
| Compound Name | 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 43952994 |
| Molecular Formula | C18H24ClN3S |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-cyclohexylthiourea |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1CCNC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C18H24ClN3S/c1-12-15(16-11-13(19)7-8-17(16)21-12)9-10-20-18(23)22-14-5-3-2-4-6-14/h7-8,11,14,21H,2-6,9-10H2,1H3,(H2,20,22,23) |
| InChIKey | HQDOLQHTNZREPM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|