C20H28ClN3O4 — CID 155971564
acetic acid;(1S,3R,4R)-4-amino-N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-hydroxycyclohexane-1-carboxamide (PubChem CID 155971564) has the molecular formula C20H28ClN3O4 and a molecular weight of 409.91 g/mol. Its IUPAC name is acetic acid;(1S,3R,4R)-4-amino-N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-hydroxycyclohexane-1-carboxamide.
| Compound Name | acetic acid;(1S,3R,4R)-4-amino-N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 155971564 |
| Molecular Formula | C20H28ClN3O4 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | acetic acid;(1S,3R,4R)-4-amino-N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-hydroxycyclohexane-1-carboxamide |
| SMILES | CC(=O)O.Cc1[nH]c2ccc(Cl)cc2c1CCNC(=O)[C@H]1CC[C@@H](N)[C@H](O)C1 |
| InChI | InChI=1S/C18H24ClN3O2.C2H4O2/c1-10-13(14-9-12(19)3-5-16(14)22-10)6-7-21-18(24)11-2-4-15(20)17(23)8-11;1-2(3)4/h3,5,9,11,15,17,22-23H,2,4,6-8,20H2,1H3,(H,21,24);1H3,(H,3,4)/t11-,15+,17+;/m0./s1 |
| InChIKey | NGRWJXFXFPRTLG-FYCRXMNZSA-N |
| XLogP | 2.37 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|