C19H26N2O — CID 113086180
N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]cyclohexanecarboxamide (PubChem CID 113086180) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 113086180 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]cyclohexanecarboxamide |
| SMILES | Cc1ccc2[nH]c(C)c(CCNC(=O)C3CCCCC3)c2c1 |
| InChI | InChI=1S/C19H26N2O/c1-13-8-9-18-17(12-13)16(14(2)21-18)10-11-20-19(22)15-6-4-3-5-7-15/h8-9,12,15,21H,3-7,10-11H2,1-2H3,(H,20,22) |
| InChIKey | NFHQKSABFHVHJI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|