C18H24FN3O — CID 166276508
cis-(1R,3S)-3-amino-N-[2-(6-fluoro-2-methyl-1H-indol-3-yl)ethyl]cyclohexane-1-carboxamide (PubChem CID 166276508) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is cis-(1R,3S)-3-amino-N-[2-(6-fluoro-2-methyl-1H-indol-3-yl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-3-amino-N-[2-(6-fluoro-2-methyl-1H-indol-3-yl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166276508 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | cis-(1R,3S)-3-amino-N-[2-(6-fluoro-2-methyl-1H-indol-3-yl)ethyl]cyclohexane-1-carboxamide |
| SMILES | Cc1[nH]c2cc(F)ccc2c1CCNC(=O)[C@@H]1CCC[C@H](N)C1 |
| InChI | InChI=1S/C18H24FN3O/c1-11-15(16-6-5-13(19)10-17(16)22-11)7-8-21-18(23)12-3-2-4-14(20)9-12/h5-6,10,12,14,22H,2-4,7-9,20H2,1H3,(H,21,23)/t12-,14+/m1/s1 |
| InChIKey | AXQQOCWDACWZAV-OCCSQVGLSA-N |
| XLogP | 2.79 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|