C26H30FN3O2 — CID 42534943
N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide (PubChem CID 42534943) has the molecular formula C26H30FN3O2 and a molecular weight of 435.54 g/mol. Its IUPAC name is N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42534943 |
| Molecular Formula | C26H30FN3O2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CCNC(=O)C1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H30FN3O2/c1-18-22(23-17-21(27)8-9-24(23)29-18)11-14-28-26(32)20-12-15-30(16-13-20)25(31)10-7-19-5-3-2-4-6-19/h2-6,8-9,17,20,29H,7,10-16H2,1H3,(H,28,32) |
| InChIKey | PBODJQFFOQYIGU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|