C27H32FN3O5 — CID 42534718
N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide (PubChem CID 42534718) has the molecular formula C27H32FN3O5 and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42534718 |
| Molecular Formula | C27H32FN3O5 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide |
| SMILES | COc1cc(C(=O)N2CCC(C(=O)NCCc3c(C)[nH]c4ccc(F)cc34)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C27H32FN3O5/c1-16-20(21-15-19(28)5-6-22(21)30-16)7-10-29-26(32)17-8-11-31(12-9-17)27(33)18-13-23(34-2)25(36-4)24(14-18)35-3/h5-6,13-15,17,30H,7-12H2,1-4H3,(H,29,32) |
| InChIKey | DSSKNEGSCFGFSM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|