C28H37N3O5 — CID 42693279
N-benzyl-1-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 42693279) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-benzyl-1-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42693279 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | N-benzyl-1-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | COc1cc(C(=O)N2CCC(N3CCC(C(=O)NCc4ccccc4)CC3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C28H37N3O5/c1-34-24-17-22(18-25(35-2)26(24)36-3)28(33)31-15-11-23(12-16-31)30-13-9-21(10-14-30)27(32)29-19-20-7-5-4-6-8-20/h4-8,17-18,21,23H,9-16,19H2,1-3H3,(H,29,32) |
| InChIKey | RRXKQTNDGUKRHI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |