C17H22ClN3O2 — CID 155498993
(1S,3R,4R)-3-amino-N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-4-hydroxycyclopentane-1-carboxamide (PubChem CID 155498993) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is (1S,3R,4R)-3-amino-N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-4-hydroxycyclopentane-1-carboxamide.
| Compound Name | (1S,3R,4R)-3-amino-N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-4-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 155498993 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (1S,3R,4R)-3-amino-N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-4-hydroxycyclopentane-1-carboxamide |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1CCNC(=O)[C@H]1C[C@@H](N)[C@H](O)C1 |
| InChI | InChI=1S/C17H22ClN3O2/c1-9-12(13-8-11(18)2-3-15(13)21-9)4-5-20-17(23)10-6-14(19)16(22)7-10/h2-3,8,10,14,16,21-22H,4-7,19H2,1H3,(H,20,23)/t10-,14+,16+/m0/s1 |
| InChIKey | FPTGLFWUUITSQY-DRZCJDIDSA-N |
| XLogP | 1.89 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|