C18H24ClN3O2 — CID 119063925
1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-[1-(hydroxymethyl)cyclopentyl]urea (PubChem CID 119063925) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-[1-(hydroxymethyl)cyclopentyl]urea.
| Compound Name | 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-[1-(hydroxymethyl)cyclopentyl]urea |
|---|---|
| PubChem CID | 119063925 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-[1-(hydroxymethyl)cyclopentyl]urea |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1CCNC(=O)NC1(CO)CCCC1 |
| InChI | InChI=1S/C18H24ClN3O2/c1-12-14(15-10-13(19)4-5-16(15)21-12)6-9-20-17(24)22-18(11-23)7-2-3-8-18/h4-5,10,21,23H,2-3,6-9,11H2,1H3,(H2,20,22,24) |
| InChIKey | AKAURJNQKDQLGI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|