C20H28N4O2 — CID 72926271
1-N,1-N-dimethyl-3-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-1,3-dicarboxamide (PubChem CID 72926271) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-3-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-1,3-dicarboxamide.
| Compound Name | 1-N,1-N-dimethyl-3-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 72926271 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-N,1-N-dimethyl-3-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-1,3-dicarboxamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)C1CCCN(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C20H28N4O2/c1-14-16(17-8-4-5-9-18(17)22-14)10-11-21-19(25)15-7-6-12-24(13-15)20(26)23(2)3/h4-5,8-9,15,22H,6-7,10-13H2,1-3H3,(H,21,25) |
| InChIKey | KGEJXQJEAICNFG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|