C25H29N5O — CID 126470752
1-(1-methylbenzimidazol-2-yl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-3-carboxamide (PubChem CID 126470752) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-(1-methylbenzimidazol-2-yl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(1-methylbenzimidazol-2-yl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126470752 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-(1-methylbenzimidazol-2-yl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)C1CCCN(c2nc3ccccc3n2C)C1 |
| InChI | InChI=1S/C25H29N5O/c1-17-19(20-9-3-4-10-21(20)27-17)13-14-26-24(31)18-8-7-15-30(16-18)25-28-22-11-5-6-12-23(22)29(25)2/h3-6,9-12,18,27H,7-8,13-16H2,1-2H3,(H,26,31) |
| InChIKey | WRQWOSCSYOHBPT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|