C24H36N4O — CID 86888651
3-(azepan-1-ylmethyl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-1-carboxamide (PubChem CID 86888651) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is 3-(azepan-1-ylmethyl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-1-carboxamide.
| Compound Name | 3-(azepan-1-ylmethyl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86888651 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 3-(azepan-1-ylmethyl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]piperidine-1-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)N1CCCC(CN2CCCCCC2)C1 |
| InChI | InChI=1S/C24H36N4O/c1-19-21(22-10-4-5-11-23(22)26-19)12-13-25-24(29)28-16-8-9-20(18-28)17-27-14-6-2-3-7-15-27/h4-5,10-11,20,26H,2-3,6-9,12-18H2,1H3,(H,25,29) |
| InChIKey | HRLUQORALTUHIX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|