C16H22N2O — CID 98032942
N-[3-(5-methoxy-2-methyl-1H-indol-3-yl)propyl]cyclopropanamine (PubChem CID 98032942) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-[3-(5-methoxy-2-methyl-1H-indol-3-yl)propyl]cyclopropanamine.
| Compound Name | N-[3-(5-methoxy-2-methyl-1H-indol-3-yl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 98032942 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[3-(5-methoxy-2-methyl-1H-indol-3-yl)propyl]cyclopropanamine |
| SMILES | COc1ccc2[nH]c(C)c(CCCNC3CC3)c2c1 |
| InChI | InChI=1S/C16H22N2O/c1-11-14(4-3-9-17-12-5-6-12)15-10-13(19-2)7-8-16(15)18-11/h7-8,10,12,17-18H,3-6,9H2,1-2H3 |
| InChIKey | RCQLVFZZZOCHME-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|