C18H27ClN2O — CID 21313363
5-methoxy-2-methyl-3-[2-(2-methylpiperidin-1-yl)ethyl]-1H-indole;hydrochloride (PubChem CID 21313363) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is 5-methoxy-2-methyl-3-[2-(2-methylpiperidin-1-yl)ethyl]-1H-indole;hydrochloride.
| Compound Name | 5-methoxy-2-methyl-3-[2-(2-methylpiperidin-1-yl)ethyl]-1H-indole;hydrochloride |
|---|---|
| PubChem CID | 21313363 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 5-methoxy-2-methyl-3-[2-(2-methylpiperidin-1-yl)ethyl]-1H-indole;hydrochloride |
| SMILES | COc1ccc2[nH]c(C)c(CCN3CCCCC3C)c2c1.Cl |
| InChI | InChI=1S/C18H26N2O.ClH/c1-13-6-4-5-10-20(13)11-9-16-14(2)19-18-8-7-15(21-3)12-17(16)18;/h7-8,12-13,19H,4-6,9-11H2,1-3H3;1H |
| InChIKey | VKNJAJDFISKDLS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|