C23H34N2O — CID 21313343
3-[2-(4-cyclohexylpiperidin-1-yl)ethyl]-5-methoxy-2-methyl-1H-indole (PubChem CID 21313343) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is 3-[2-(4-cyclohexylpiperidin-1-yl)ethyl]-5-methoxy-2-methyl-1H-indole.
| Compound Name | 3-[2-(4-cyclohexylpiperidin-1-yl)ethyl]-5-methoxy-2-methyl-1H-indole |
|---|---|
| PubChem CID | 21313343 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 3-[2-(4-cyclohexylpiperidin-1-yl)ethyl]-5-methoxy-2-methyl-1H-indole |
| SMILES | COc1ccc2[nH]c(C)c(CCN3CCC(C4CCCCC4)CC3)c2c1 |
| InChI | InChI=1S/C23H34N2O/c1-17-21(22-16-20(26-2)8-9-23(22)24-17)12-15-25-13-10-19(11-14-25)18-6-4-3-5-7-18/h8-9,16,18-19,24H,3-7,10-15H2,1-2H3 |
| InChIKey | GRPWBQYDNLSHCW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|