C20H24N2O5S — CID 3419914
2,5-dimethoxy-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 3419914) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3419914 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2,5-dimethoxy-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCc2c(C)[nH]c3ccc(OC)cc23)c1 |
| InChI | InChI=1S/C20H24N2O5S/c1-13-16(17-11-14(25-2)5-7-18(17)22-13)9-10-21-28(23,24)20-12-15(26-3)6-8-19(20)27-4/h5-8,11-12,21-22H,9-10H2,1-4H3 |
| InChIKey | ALJAEIFEMJGJFT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|