C19H22N2O4S — CID 113085538
2,4-dimethoxy-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 113085538) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113085538 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2,4-dimethoxy-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2c(C)[nH]c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O4S/c1-13-15(16-6-4-5-7-17(16)21-13)10-11-20-26(22,23)19-9-8-14(24-2)12-18(19)25-3/h4-9,12,20-21H,10-11H2,1-3H3 |
| InChIKey | MTYPRLMCJOGOHU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|