C29H26N2O3S — CID 24825401
N-[2-[2-(4-methoxyphenyl)-1H-indol-3-yl]ethyl]-4-phenylbenzenesulfonamide (PubChem CID 24825401) has the molecular formula C29H26N2O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-[2-[2-(4-methoxyphenyl)-1H-indol-3-yl]ethyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[2-[2-(4-methoxyphenyl)-1H-indol-3-yl]ethyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 24825401 |
| Molecular Formula | C29H26N2O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-[2-[2-(4-methoxyphenyl)-1H-indol-3-yl]ethyl]-4-phenylbenzenesulfonamide |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2CCNS(=O)(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H26N2O3S/c1-34-24-15-11-23(12-16-24)29-27(26-9-5-6-10-28(26)31-29)19-20-30-35(32,33)25-17-13-22(14-18-25)21-7-3-2-4-8-21/h2-18,30-31H,19-20H2,1H3 |
| InChIKey | UZSQEWGGVBQCFO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |