C25H25N3O3S — CID 24825363
N-[2-[4-(4-methoxyphenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]-4-methylbenzenesulfonamide (PubChem CID 24825363) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24825363 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)[nH]c2CCNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c1-18-8-14-22(15-9-18)32(29,30)26-17-16-23-24(19-10-12-21(31-2)13-11-19)28-25(27-23)20-6-4-3-5-7-20/h3-15,26H,16-17H2,1-2H3,(H,27,28) |
| InChIKey | DSLOKYMAUNMOMC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |