C30H35N3O4S — CID 24825348
N-[2-[2,4-bis(4-methoxyphenyl)-1H-imidazol-5-yl]ethyl]-4-pentylbenzenesulfonamide (PubChem CID 24825348) has the molecular formula C30H35N3O4S and a molecular weight of 533.69 g/mol. Its IUPAC name is N-[2-[2,4-bis(4-methoxyphenyl)-1H-imidazol-5-yl]ethyl]-4-pentylbenzenesulfonamide.
| Compound Name | N-[2-[2,4-bis(4-methoxyphenyl)-1H-imidazol-5-yl]ethyl]-4-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 24825348 |
| Molecular Formula | C30H35N3O4S |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | N-[2-[2,4-bis(4-methoxyphenyl)-1H-imidazol-5-yl]ethyl]-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2[nH]c(-c3ccc(OC)cc3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O4S/c1-4-5-6-7-22-8-18-27(19-9-22)38(34,35)31-21-20-28-29(23-10-14-25(36-2)15-11-23)33-30(32-28)24-12-16-26(37-3)17-13-24/h8-19,31H,4-7,20-21H2,1-3H3,(H,32,33) |
| InChIKey | AAASTTXAYJCATC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|