C28H30FN3O2S — CID 24825346
N-[2-[4-(4-fluorophenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]-4-pentylbenzenesulfonamide (PubChem CID 24825346) has the molecular formula C28H30FN3O2S and a molecular weight of 491.63 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]-4-pentylbenzenesulfonamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]-4-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 24825346 |
| Molecular Formula | C28H30FN3O2S |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2[nH]c(-c3ccccc3)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H30FN3O2S/c1-2-3-5-8-21-11-17-25(18-12-21)35(33,34)30-20-19-26-27(22-13-15-24(29)16-14-22)32-28(31-26)23-9-6-4-7-10-23/h4,6-7,9-18,30H,2-3,5,8,19-20H2,1H3,(H,31,32) |
| InChIKey | FAZSWVVIXMDBTB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|