C22H26N2O4S — CID 11625805
3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indole-2-carboxylic acid (PubChem CID 11625805) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 11625805 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indole-2-carboxylic acid |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(C(=O)O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H26N2O4S/c1-2-3-4-7-16-10-12-17(13-11-16)29(27,28)23-15-14-19-18-8-5-6-9-20(18)24-21(19)22(25)26/h5-6,8-13,23-24H,2-4,7,14-15H2,1H3,(H,25,26) |
| InChIKey | VASWQBZXXKVDQM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|