C33H40N4O3S — CID 58615595
N-[2-[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide (PubChem CID 58615595) has the molecular formula C33H40N4O3S and a molecular weight of 572.78 g/mol. Its IUPAC name is N-[2-[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide.
| Compound Name | N-[2-[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 58615595 |
| Molecular Formula | C33H40N4O3S |
| Molecular Weight | 572.78 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | N-[2-[2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3ccc(C(=O)N4CCN(C)CC4)cc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C33H40N4O3S/c1-3-4-5-8-25-11-17-28(18-12-25)41(39,40)34-20-19-30-29-9-6-7-10-31(29)35-32(30)26-13-15-27(16-14-26)33(38)37-23-21-36(2)22-24-37/h6-7,9-18,34-35H,3-5,8,19-24H2,1-2H3 |
| InChIKey | CZXZKFLDGPODGN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.78 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|