C32H39N3O3S — CID 58615587
3-methyl-N-[3-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]phenyl]butanamide (PubChem CID 58615587) has the molecular formula C32H39N3O3S and a molecular weight of 545.75 g/mol. Its IUPAC name is 3-methyl-N-[3-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]phenyl]butanamide.
| Compound Name | 3-methyl-N-[3-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 58615587 |
| Molecular Formula | C32H39N3O3S |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 3-methyl-N-[3-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]phenyl]butanamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3cccc(NC(=O)CC(C)C)c3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C32H39N3O3S/c1-4-5-6-10-24-15-17-27(18-16-24)39(37,38)33-20-19-29-28-13-7-8-14-30(28)35-32(29)25-11-9-12-26(22-25)34-31(36)21-23(2)3/h7-9,11-18,22-23,33,35H,4-6,10,19-21H2,1-3H3,(H,34,36) |
| InChIKey | NDTMXESVKFCGST-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|