C33H42N4O3S — CID 58615581
N-[2-(dimethylamino)ethyl]-N-methyl-4-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]benzamide (PubChem CID 58615581) has the molecular formula C33H42N4O3S and a molecular weight of 574.79 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-methyl-4-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-methyl-4-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]benzamide |
|---|---|
| PubChem CID | 58615581 |
| Molecular Formula | C33H42N4O3S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-methyl-4-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]benzamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3ccc(C(=O)N(C)CCN(C)C)cc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C33H42N4O3S/c1-5-6-7-10-25-13-19-28(20-14-25)41(39,40)34-22-21-30-29-11-8-9-12-31(29)35-32(30)26-15-17-27(18-16-26)33(38)37(4)24-23-36(2)3/h8-9,11-20,34-35H,5-7,10,21-24H2,1-4H3 |
| InChIKey | QITYFKZMXBCADJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|