C24H28N2O4S — CID 45139309
butyl (E)-3-[3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]prop-2-enoate (PubChem CID 45139309) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is butyl (E)-3-[3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]prop-2-enoate.
| Compound Name | butyl (E)-3-[3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 45139309 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | butyl (E)-3-[3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1[nH]c2ccccc2c1CCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28N2O4S/c1-3-4-17-30-24(27)14-13-23-21(20-7-5-6-8-22(20)26-23)15-16-25-31(28,29)19-11-9-18(2)10-12-19/h5-14,25-26H,3-4,15-17H2,1-2H3/b14-13+ |
| InChIKey | KDAALGKEBYHGIR-BUHFOSPRSA-N |
| XLogP | 4.35 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|