C31H35N3O3S — CID 58615620
N-[3-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]phenyl]cyclopropanecarboxamide (PubChem CID 58615620) has the molecular formula C31H35N3O3S and a molecular weight of 529.71 g/mol. Its IUPAC name is N-[3-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 58615620 |
| Molecular Formula | C31H35N3O3S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | N-[3-[3-[2-[(4-pentylphenyl)sulfonylamino]ethyl]-1H-indol-2-yl]phenyl]cyclopropanecarboxamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3cccc(NC(=O)C4CC4)c3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C31H35N3O3S/c1-2-3-4-8-22-13-17-26(18-14-22)38(36,37)32-20-19-28-27-11-5-6-12-29(27)34-30(28)24-9-7-10-25(21-24)33-31(35)23-15-16-23/h5-7,9-14,17-18,21,23,32,34H,2-4,8,15-16,19-20H2,1H3,(H,33,35) |
| InChIKey | DJICUOYIYFSBJE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|