C35H37N3O2S — CID 11713843
4-pentyl-N-[2-[2-[3-(1-phenylethenylamino)phenyl]-1H-indol-3-yl]ethyl]benzenesulfonamide (PubChem CID 11713843) has the molecular formula C35H37N3O2S and a molecular weight of 563.77 g/mol. Its IUPAC name is 4-pentyl-N-[2-[2-[3-(1-phenylethenylamino)phenyl]-1H-indol-3-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-pentyl-N-[2-[2-[3-(1-phenylethenylamino)phenyl]-1H-indol-3-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11713843 |
| Molecular Formula | C35H37N3O2S |
| Molecular Weight | 563.77 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | 4-pentyl-N-[2-[2-[3-(1-phenylethenylamino)phenyl]-1H-indol-3-yl]ethyl]benzenesulfonamide |
| SMILES | C=C(Nc1cccc(-c2[nH]c3ccccc3c2CCNS(=O)(=O)c2ccc(CCCCC)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C35H37N3O2S/c1-3-4-6-12-27-19-21-31(22-20-27)41(39,40)36-24-23-33-32-17-9-10-18-34(32)38-35(33)29-15-11-16-30(25-29)37-26(2)28-13-7-5-8-14-28/h5,7-11,13-22,25,36-38H,2-4,6,12,23-24H2,1H3 |
| InChIKey | DVPLZQMOFREWAN-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.77 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|