C18H17F3N2O2S2 — CID 71502039
4-methyl-N-[2-[2-(trifluoromethylsulfanyl)-1H-indol-3-yl]ethyl]benzenesulfonamide (PubChem CID 71502039) has the molecular formula C18H17F3N2O2S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 4-methyl-N-[2-[2-(trifluoromethylsulfanyl)-1H-indol-3-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[2-(trifluoromethylsulfanyl)-1H-indol-3-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71502039 |
| Molecular Formula | C18H17F3N2O2S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 4-methyl-N-[2-[2-(trifluoromethylsulfanyl)-1H-indol-3-yl]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2c(SC(F)(F)F)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C18H17F3N2O2S2/c1-12-6-8-13(9-7-12)27(24,25)22-11-10-15-14-4-2-3-5-16(14)23-17(15)26-18(19,20)21/h2-9,22-23H,10-11H2,1H3 |
| InChIKey | HUIDQOHLXQDDPW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |