C21H26N2O3S — CID 113086277
N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-4-propan-2-yloxybenzenesulfonamide (PubChem CID 113086277) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 113086277 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-4-propan-2-yloxybenzenesulfonamide |
| SMILES | Cc1ccc2[nH]c(C)c(CCNS(=O)(=O)c3ccc(OC(C)C)cc3)c2c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-14(2)26-17-6-8-18(9-7-17)27(24,25)22-12-11-19-16(4)23-21-10-5-15(3)13-20(19)21/h5-10,13-14,22-23H,11-12H2,1-4H3 |
| InChIKey | ZDQJDAKPVZAWFL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|