C20H24N2O2S — CID 113086252
N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-2,4-dimethylbenzenesulfonamide (PubChem CID 113086252) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113086252 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2c(C)[nH]c3ccc(C)cc23)c(C)c1 |
| InChI | InChI=1S/C20H24N2O2S/c1-13-6-8-20(15(3)11-13)25(23,24)21-10-9-17-16(4)22-19-7-5-14(2)12-18(17)19/h5-8,11-12,21-22H,9-10H2,1-4H3 |
| InChIKey | JMOYEHSWGQOWRB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|