C13H13ClN2O2 — CID 134097117
N-(2-aminoethyl)-4-chloro-1-hydroxynaphthalene-2-carboxamide (PubChem CID 134097117) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-chloro-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-4-chloro-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 134097117 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-(2-aminoethyl)-4-chloro-1-hydroxynaphthalene-2-carboxamide |
| SMILES | NCCNC(=O)c1cc(Cl)c2ccccc2c1O |
| InChI | InChI=1S/C13H13ClN2O2/c14-11-7-10(13(18)16-6-5-15)12(17)9-4-2-1-3-8(9)11/h1-4,7,17H,5-6,15H2,(H,16,18) |
| InChIKey | JYOYUUHXSRVXMB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |