C20H14O9S2 — CID 59734837
6-hydroxy-8-(2-methylprop-2-enoyloxy)-3-sulfinooxypyrene-1-sulfonic acid (PubChem CID 59734837) has the molecular formula C20H14O9S2 and a molecular weight of 462.46 g/mol. Its IUPAC name is 6-hydroxy-8-(2-methylprop-2-enoyloxy)-3-sulfinooxypyrene-1-sulfonic acid.
| Compound Name | 6-hydroxy-8-(2-methylprop-2-enoyloxy)-3-sulfinooxypyrene-1-sulfonic acid |
|---|---|
| PubChem CID | 59734837 |
| Molecular Formula | C20H14O9S2 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | 6-hydroxy-8-(2-methylprop-2-enoyloxy)-3-sulfinooxypyrene-1-sulfonic acid |
| SMILES | C=C(C)C(=O)Oc1cc(O)c2ccc3c(OS(=O)O)cc(S(=O)(=O)O)c4ccc1c2c34 |
| InChI | InChI=1S/C20H14O9S2/c1-9(2)20(22)28-15-7-14(21)10-3-4-12-16(29-30(23)24)8-17(31(25,26)27)13-6-5-11(15)18(10)19(12)13/h3-8,21H,1H2,2H3,(H,23,24)(H,25,26,27) |
| InChIKey | CWNQEBBBLDPPFA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|