C22H20O11S3 — CID 169178861
8-hexanoyloxypyrene-1,3,6-trisulfonic acid (PubChem CID 169178861) has the molecular formula C22H20O11S3 and a molecular weight of 556.59 g/mol. Its IUPAC name is 8-hexanoyloxypyrene-1,3,6-trisulfonic acid.
| Compound Name | 8-hexanoyloxypyrene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 169178861 |
| Molecular Formula | C22H20O11S3 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | 8-hexanoyloxypyrene-1,3,6-trisulfonic acid |
| SMILES | CCCCCC(=O)Oc1cc(S(=O)(=O)O)c2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)c4ccc1c2c43 |
| InChI | InChI=1S/C22H20O11S3/c1-2-3-4-5-20(23)33-16-10-17(34(24,25)26)13-8-9-15-19(36(30,31)32)11-18(35(27,28)29)14-7-6-12(16)21(13)22(14)15/h6-11H,2-5H2,1H3,(H,24,25,26)(H,27,28,29)(H,30,31,32) |
| InChIKey | SURUZZRXFIGSMG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 189.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|