C24H24O14S3 — CID 173023150
(3,6,8-trisulfooxypyren-1-yl) octanoate (PubChem CID 173023150) has the molecular formula C24H24O14S3 and a molecular weight of 632.64 g/mol. Its IUPAC name is (3,6,8-trisulfooxypyren-1-yl) octanoate.
| Compound Name | (3,6,8-trisulfooxypyren-1-yl) octanoate |
|---|---|
| PubChem CID | 173023150 |
| Molecular Formula | C24H24O14S3 |
| Molecular Weight | 632.64 g/mol |
| Exact Mass | 632.03 |
| IUPAC Name | (3,6,8-trisulfooxypyren-1-yl) octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc(OS(=O)(=O)O)c2ccc3c(OS(=O)(=O)O)cc(OS(=O)(=O)O)c4ccc1c2c43 |
| InChI | InChI=1S/C24H24O14S3/c1-2-3-4-5-6-7-22(25)35-18-12-19(36-39(26,27)28)15-10-11-17-21(38-41(32,33)34)13-20(37-40(29,30)31)16-9-8-14(18)23(15)24(16)17/h8-13H,2-7H2,1H3,(H,26,27,28)(H,29,30,31)(H,32,33,34) |
| InChIKey | HOBYFSZOWKFQEB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|